About 1-[(1,5-dimethyl-1,2,4-triazol-3-yl)methyl]piperidine
1-[(1,5-dimethyl-1,2,4-triazol-3-yl)methyl]piperidine (PubChem CID 20791667) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-[(1,5-dimethyl-1,2,4-triazol-3-yl)methyl]piperidine.
Analyze 1-[(1,5-dimethyl-1,2,4-triazol-3-yl)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,5-dimethyl-1,2,4-triazol-3-yl)methyl]piperidine?
The IUPAC name of 1-[(1,5-dimethyl-1,2,4-triazol-3-yl)methyl]piperidine (CID 20791667) is 1-[(1,5-dimethyl-1,2,4-triazol-3-yl)methyl]piperidine.
What is the SMILES notation for 1-[(1,5-dimethyl-1,2,4-triazol-3-yl)methyl]piperidine?
The canonical SMILES for 1-[(1,5-dimethyl-1,2,4-triazol-3-yl)methyl]piperidine is Cc1nc(CN2CCCCC2)nn1C.
What is the InChIKey of 1-[(1,5-dimethyl-1,2,4-triazol-3-yl)methyl]piperidine?
The InChIKey is QVVBAFAQVZAVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c1-9-11-10(12-13(9)2)8-14-6-4-3-5-7-14/h3-8H2,1-2H3.
What are the key properties of 1-[(1,5-dimethyl-1,2,4-triazol-3-yl)methyl]piperidine?
1-[(1,5-dimethyl-1,2,4-triazol-3-yl)methyl]piperidine has a molecular weight of 194.28 g/mol, XLogP of 1.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,5-dimethyl-1,2,4-triazol-3-yl)methyl]piperidine is sourced from PubChem (CID 20791667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).