About N-methyl-2-(5-methyl-1,2,4-triazol-1-yl)ethanamine
N-methyl-2-(5-methyl-1,2,4-triazol-1-yl)ethanamine (PubChem CID 20791729) has the molecular formula C6H12N4
and a molecular weight of 140.19 g/mol. Its IUPAC name is N-methyl-2-(5-methyl-1,2,4-triazol-1-yl)ethanamine.
Analyze N-methyl-2-(5-methyl-1,2,4-triazol-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(5-methyl-1,2,4-triazol-1-yl)ethanamine?
The IUPAC name of N-methyl-2-(5-methyl-1,2,4-triazol-1-yl)ethanamine (CID 20791729) is N-methyl-2-(5-methyl-1,2,4-triazol-1-yl)ethanamine.
What is the SMILES notation for N-methyl-2-(5-methyl-1,2,4-triazol-1-yl)ethanamine?
The canonical SMILES for N-methyl-2-(5-methyl-1,2,4-triazol-1-yl)ethanamine is CNCCn1ncnc1C.
What is the InChIKey of N-methyl-2-(5-methyl-1,2,4-triazol-1-yl)ethanamine?
The InChIKey is KXGPNTKJNSKSCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4/c1-6-8-5-9-10(6)4-3-7-2/h5,7H,3-4H2,1-2H3.
What are the key properties of N-methyl-2-(5-methyl-1,2,4-triazol-1-yl)ethanamine?
N-methyl-2-(5-methyl-1,2,4-triazol-1-yl)ethanamine has a molecular weight of 140.19 g/mol, XLogP of -0.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(5-methyl-1,2,4-triazol-1-yl)ethanamine is sourced from PubChem (CID 20791729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).