C18H22N2O3S — CID 20792319
(2S)-N-(3-acetylphenyl)-2-amino-4-phenylbutane-1-sulfonamide (PubChem CID 20792319) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is (2S)-N-(3-acetylphenyl)-2-amino-4-phenylbutane-1-sulfonamide.
| Compound Name | (2S)-N-(3-acetylphenyl)-2-amino-4-phenylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 20792319 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (2S)-N-(3-acetylphenyl)-2-amino-4-phenylbutane-1-sulfonamide |
| SMILES | CC(=O)c1cccc(NS(=O)(=O)C[C@@H](N)CCc2ccccc2)c1 |
| InChI | InChI=1S/C18H22N2O3S/c1-14(21)16-8-5-9-18(12-16)20-24(22,23)13-17(19)11-10-15-6-3-2-4-7-15/h2-9,12,17,20H,10-11,13,19H2,1H3/t17-/m0/s1 |
| InChIKey | URIQGGVVYPQTQU-KRWDZBQOSA-N |
| XLogP | 2.59 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |