About ethyl 3-(2-fluorobenzene-5-id-1-yl)-3-oxopropanoate;yttrium(3+)
ethyl 3-(2-fluorobenzene-5-id-1-yl)-3-oxopropanoate;yttrium(3+) (PubChem CID 20794285) has the molecular formula C11H10FO3Y+2
and a molecular weight of 298.10 g/mol. Its IUPAC name is ethyl 3-(2-fluorobenzene-5-id-1-yl)-3-oxopropanoate;yttrium(3+).
Molecular Properties
| Compound Name | ethyl 3-(2-fluorobenzene-5-id-1-yl)-3-oxopropanoate;yttrium(3+) |
| PubChem CID | 20794285 |
| Molecular Formula | C11H10FO3Y+2 |
| Molecular Weight | 298.10 g/mol |
| Exact Mass | 297.97 |
| IUPAC Name | ethyl 3-(2-fluorobenzene-5-id-1-yl)-3-oxopropanoate;yttrium(3+) |
| SMILES | CCOC(=O)CC(=O)c1c[c-]ccc1F.[Y+3] |
| InChI | InChI=1S/C11H10FO3.Y/c1-2-15-11(14)7-10(13)8-5-3-4-6-9(8)12;/h4-6H,2,7H2,1H3;/q-1;+3 |
| InChIKey | HMWSHYZTEBWOGK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.10 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(2-fluorobenzene-5-id-1-yl)-3-oxopropanoate;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2-fluorobenzene-5-id-1-yl)-3-oxopropanoate;yttrium(3+)?
The IUPAC name of ethyl 3-(2-fluorobenzene-5-id-1-yl)-3-oxopropanoate;yttrium(3+) (CID 20794285) is ethyl 3-(2-fluorobenzene-5-id-1-yl)-3-oxopropanoate;yttrium(3+).
What is the SMILES notation for ethyl 3-(2-fluorobenzene-5-id-1-yl)-3-oxopropanoate;yttrium(3+)?
The canonical SMILES for ethyl 3-(2-fluorobenzene-5-id-1-yl)-3-oxopropanoate;yttrium(3+) is CCOC(=O)CC(=O)c1c[c-]ccc1F.[Y+3].
What is the InChIKey of ethyl 3-(2-fluorobenzene-5-id-1-yl)-3-oxopropanoate;yttrium(3+)?
The InChIKey is HMWSHYZTEBWOGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FO3.Y/c1-2-15-11(14)7-10(13)8-5-3-4-6-9(8)12;/h4-6H,2,7H2,1H3;/q-1;+3.
What are the key properties of ethyl 3-(2-fluorobenzene-5-id-1-yl)-3-oxopropanoate;yttrium(3+)?
ethyl 3-(2-fluorobenzene-5-id-1-yl)-3-oxopropanoate;yttrium(3+) has a molecular weight of 298.10 g/mol, XLogP of 1.76, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2-fluorobenzene-5-id-1-yl)-3-oxopropanoate;yttrium(3+) is sourced from PubChem (CID 20794285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).