C19H24N2O4 — CID 20799060
1-[(8aS)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-4-(3,4-dimethoxyphenyl)butane-1,4-dione (PubChem CID 20799060) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-[(8aS)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-4-(3,4-dimethoxyphenyl)butane-1,4-dione.
| Compound Name | 1-[(8aS)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-4-(3,4-dimethoxyphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 20799060 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[(8aS)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-4-(3,4-dimethoxyphenyl)butane-1,4-dione |
| SMILES | COc1ccc(C(=O)CCC(=O)N2CCN3C=CC[C@H]3C2)cc1OC |
| InChI | InChI=1S/C19H24N2O4/c1-24-17-7-5-14(12-18(17)25-2)16(22)6-8-19(23)21-11-10-20-9-3-4-15(20)13-21/h3,5,7,9,12,15H,4,6,8,10-11,13H2,1-2H3/t15-/m0/s1 |
| InChIKey | BQRSJQMBVCYKCK-HNNXBMFYSA-N |
| XLogP | 2.10 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |