C21H16FN5O5S2 — CID 20800169
1-[6-(6,8-Dioxo-1,2,3,9-tetrahydropyrrolo[3,2-f]isoquinolin-7-yl)-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea (PubChem CID 20800169) has the molecular formula C21H16FN5O5S2 and a molecular weight of 501.50 g/mol. Its IUPAC name is 1-[6-(6,8-dioxo-1,2,3,9-tetrahydropyrrolo[3,2-f]isoquinolin-7-yl)-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea.
| Compound Name | 1-[6-(6,8-Dioxo-1,2,3,9-tetrahydropyrrolo[3,2-f]isoquinolin-7-yl)-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea |
|---|---|
| PubChem CID | 20800169 |
| Molecular Formula | C21H16FN5O5S2 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | 1-[6-(6,8-dioxo-1,2,3,9-tetrahydropyrrolo[3,2-f]isoquinolin-7-yl)-3-pyridinyl]-3-(5-fluorothiophen-2-yl)sulfonylurea |
| SMILES | C1CNC2=C1C3=C(C=C2)C(=O)N(C(=O)C3)C4=NC=C(C=C4)NC(=O)NS(=O)(=O)C5=CC=C(S5)F |
| InChI | InChI=1S/C21H16FN5O5S2/c22-16-4-6-19(33-16)34(31,32)26-21(30)25-11-1-5-17(24-10-11)27-18(28)9-14-12-7-8-23-15(12)3-2-13(14)20(27)29/h1-6,10,23H,7-9H2,(H2,25,26,30) |
| InChIKey | IRCUGFWANGWGOH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 174.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | 946 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|