C26H34N4O3S2 — CID 20800741
2-(4-isocyanothiophen-2-yl)-5-[4-[2-(4-methylsulfonylphenoxy)ethyl]piperazin-1-yl]-2-propan-2-ylpentanenitrile (PubChem CID 20800741) has the molecular formula C26H34N4O3S2 and a molecular weight of 514.72 g/mol. Its IUPAC name is 2-(4-isocyanothiophen-2-yl)-5-[4-[2-(4-methylsulfonylphenoxy)ethyl]piperazin-1-yl]-2-propan-2-ylpentanenitrile.
| Compound Name | 2-(4-isocyanothiophen-2-yl)-5-[4-[2-(4-methylsulfonylphenoxy)ethyl]piperazin-1-yl]-2-propan-2-ylpentanenitrile |
|---|---|
| PubChem CID | 20800741 |
| Molecular Formula | C26H34N4O3S2 |
| Molecular Weight | 514.72 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 2-(4-isocyanothiophen-2-yl)-5-[4-[2-(4-methylsulfonylphenoxy)ethyl]piperazin-1-yl]-2-propan-2-ylpentanenitrile |
| SMILES | [C-]#[N+]c1csc(C(C#N)(CCCN2CCN(CCOc3ccc(S(C)(=O)=O)cc3)CC2)C(C)C)c1 |
| InChI | InChI=1S/C26H34N4O3S2/c1-21(2)26(20-27,25-18-22(28-3)19-34-25)10-5-11-29-12-14-30(15-13-29)16-17-33-23-6-8-24(9-7-23)35(4,31)32/h6-9,18-19,21H,5,10-17H2,1-2,4H3 |
| InChIKey | PUGQGQOZMRDSCG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.72 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|