C15H21N3O3 — CID 20801699
N-[2-(2-hydroxy-5-isocyano-3,4-dimethyl-6-oxo-1-pyridinyl)ethyl]-2,2-dimethylpropanamide (PubChem CID 20801699) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[2-(2-hydroxy-5-isocyano-3,4-dimethyl-6-oxo-1-pyridinyl)ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-(2-hydroxy-5-isocyano-3,4-dimethyl-6-oxo-1-pyridinyl)ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 20801699 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[2-(2-hydroxy-5-isocyano-3,4-dimethyl-6-oxo-1-pyridinyl)ethyl]-2,2-dimethylpropanamide |
| SMILES | [C-]#[N+]c1c(C)c(C)c(O)n(CCNC(=O)C(C)(C)C)c1=O |
| InChI | InChI=1S/C15H21N3O3/c1-9-10(2)12(19)18(13(20)11(9)16-6)8-7-17-14(21)15(3,4)5/h19H,7-8H2,1-5H3,(H,17,21) |
| InChIKey | QUNYVWINBVDIGQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|