C18H19N3O3 — CID 20801703
N-[3-(2-hydroxy-5-isocyano-3,4-dimethyl-6-oxo-1-pyridinyl)propyl]benzamide (PubChem CID 20801703) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[3-(2-hydroxy-5-isocyano-3,4-dimethyl-6-oxo-1-pyridinyl)propyl]benzamide.
| Compound Name | N-[3-(2-hydroxy-5-isocyano-3,4-dimethyl-6-oxo-1-pyridinyl)propyl]benzamide |
|---|---|
| PubChem CID | 20801703 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-[3-(2-hydroxy-5-isocyano-3,4-dimethyl-6-oxo-1-pyridinyl)propyl]benzamide |
| SMILES | [C-]#[N+]c1c(C)c(C)c(O)n(CCCNC(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C18H19N3O3/c1-12-13(2)17(23)21(18(24)15(12)19-3)11-7-10-20-16(22)14-8-5-4-6-9-14/h4-6,8-9,23H,7,10-11H2,1-2H3,(H,20,22) |
| InChIKey | JPATZRLMQNOARP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|