C21H21N3O5S — CID 2080193
[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 2-methylquinoline-4-carboxylate (PubChem CID 2080193) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 2-methylquinoline-4-carboxylate.
| Compound Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 2-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2080193 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 2-methylquinoline-4-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)NCCc2ccc(S(N)(=O)=O)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C21H21N3O5S/c1-14-12-18(17-4-2-3-5-19(17)24-14)21(26)29-13-20(25)23-11-10-15-6-8-16(9-7-15)30(22,27)28/h2-9,12H,10-11,13H2,1H3,(H,23,25)(H2,22,27,28) |
| InChIKey | SJTOEQHWKVGAFO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |