C20H23N3O4 — CID 2084851
[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl] 2-methylquinoline-4-carboxylate (PubChem CID 2084851) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl] 2-methylquinoline-4-carboxylate.
| Compound Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl] 2-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2084851 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl] 2-methylquinoline-4-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)NCCCN2CCCC2=O)c2ccccc2n1 |
| InChI | InChI=1S/C20H23N3O4/c1-14-12-16(15-6-2-3-7-17(15)22-14)20(26)27-13-18(24)21-9-5-11-23-10-4-8-19(23)25/h2-3,6-7,12H,4-5,8-11,13H2,1H3,(H,21,24) |
| InChIKey | PVYAYVQZXVKBBX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|