C10H9F7 — CID 20802301
5-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)bicyclo[2.2.1]hept-2-ene (PubChem CID 20802301) has the molecular formula C10H9F7 and a molecular weight of 262.17 g/mol. Its IUPAC name is 5-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 20802301 |
| Molecular Formula | C10H9F7 |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 5-fluoro-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)bicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)C(C(F)(F)F)C1(F)CC2C=CC1C2 |
| InChI | InChI=1S/C10H9F7/c11-8(4-5-1-2-6(8)3-5)7(9(12,13)14)10(15,16)17/h1-2,5-7H,3-4H2 |
| InChIKey | LOAUREGWUYQYCX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|