C22H25N5O3S — CID 2080351
(2S)-2-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 2080351) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is (2S)-2-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | (2S)-2-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 2080351 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (2S)-2-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | COc1ccccc1-n1cnnc1S[C@@H](C)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H25N5O3S/c1-16(31-22-25-23-15-27(22)19-5-3-4-6-20(19)29-2)21(28)24-17-7-9-18(10-8-17)26-11-13-30-14-12-26/h3-10,15-16H,11-14H2,1-2H3,(H,24,28)/t16-/m0/s1 |
| InChIKey | UXAQRGLQMSGOFT-INIZCTEOSA-N |
| XLogP | 3.23 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|