C36H41NO3 — CID 20804779
N-benzyl-3-[(4-tert-butylphenyl)methoxy]-2,2-dimethyl-4-phenylmethoxy-3,4-dihydrochromen-6-amine (PubChem CID 20804779) has the molecular formula C36H41NO3 and a molecular weight of 535.73 g/mol. Its IUPAC name is N-benzyl-3-[(4-tert-butylphenyl)methoxy]-2,2-dimethyl-4-phenylmethoxy-3,4-dihydrochromen-6-amine.
| Compound Name | N-benzyl-3-[(4-tert-butylphenyl)methoxy]-2,2-dimethyl-4-phenylmethoxy-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20804779 |
| Molecular Formula | C36H41NO3 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | N-benzyl-3-[(4-tert-butylphenyl)methoxy]-2,2-dimethyl-4-phenylmethoxy-3,4-dihydrochromen-6-amine |
| SMILES | CC(C)(C)c1ccc(COC2C(OCc3ccccc3)c3cc(NCc4ccccc4)ccc3OC2(C)C)cc1 |
| InChI | InChI=1S/C36H41NO3/c1-35(2,3)29-18-16-28(17-19-29)25-39-34-33(38-24-27-14-10-7-11-15-27)31-22-30(20-21-32(31)40-36(34,4)5)37-23-26-12-8-6-9-13-26/h6-22,33-34,37H,23-25H2,1-5H3 |
| InChIKey | QGJKXVAKKSNFCQ-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|