C30H37NO4 — CID 20803698
4-butoxy-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3-phenylmethoxy-3,4-dihydrochromen-6-amine (PubChem CID 20803698) has the molecular formula C30H37NO4 and a molecular weight of 475.63 g/mol. Its IUPAC name is 4-butoxy-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3-phenylmethoxy-3,4-dihydrochromen-6-amine.
| Compound Name | 4-butoxy-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3-phenylmethoxy-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20803698 |
| Molecular Formula | C30H37NO4 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 4-butoxy-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3-phenylmethoxy-3,4-dihydrochromen-6-amine |
| SMILES | CCCCOC1c2cc(NCc3ccc(OC)cc3)ccc2OC(C)(C)C1OCc1ccccc1 |
| InChI | InChI=1S/C30H37NO4/c1-5-6-18-33-28-26-19-24(31-20-22-12-15-25(32-4)16-13-22)14-17-27(26)35-30(2,3)29(28)34-21-23-10-8-7-9-11-23/h7-17,19,28-29,31H,5-6,18,20-21H2,1-4H3 |
| InChIKey | QTPBXSJVNDUDGA-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|