C30H35NO4 — CID 20804111
[4-butoxy-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] benzoate (PubChem CID 20804111) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is [4-butoxy-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] benzoate.
| Compound Name | [4-butoxy-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] benzoate |
|---|---|
| PubChem CID | 20804111 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | [4-butoxy-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] benzoate |
| SMILES | CCCCOC1c2cc(NCc3ccc(C)cc3)ccc2OC(C)(C)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H35NO4/c1-5-6-18-33-27-25-19-24(31-20-22-14-12-21(2)13-15-22)16-17-26(25)35-30(3,4)28(27)34-29(32)23-10-8-7-9-11-23/h7-17,19,27-28,31H,5-6,18,20H2,1-4H3 |
| InChIKey | IJELTXMHQMGPAY-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|