C28H31NO4 — CID 20804599
[6-(ethylamino)-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-3-yl] benzoate (PubChem CID 20804599) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is [6-(ethylamino)-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-3-yl] benzoate.
| Compound Name | [6-(ethylamino)-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-3-yl] benzoate |
|---|---|
| PubChem CID | 20804599 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | [6-(ethylamino)-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-3-yl] benzoate |
| SMILES | CCNc1ccc2c(c1)C(OCCc1ccccc1)C(OC(=O)c1ccccc1)C(C)(C)O2 |
| InChI | InChI=1S/C28H31NO4/c1-4-29-22-15-16-24-23(19-22)25(31-18-17-20-11-7-5-8-12-20)26(28(2,3)33-24)32-27(30)21-13-9-6-10-14-21/h5-16,19,25-26,29H,4,17-18H2,1-3H3 |
| InChIKey | IUIOLOSBMHJGOO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|