C26H35NO5 — CID 20803871
[4-(2-cyclohexylethoxy)-6-(ethylamino)-2,2-dimethyl-3,4-dihydrochromen-3-yl] furan-2-carboxylate (PubChem CID 20803871) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is [4-(2-cyclohexylethoxy)-6-(ethylamino)-2,2-dimethyl-3,4-dihydrochromen-3-yl] furan-2-carboxylate.
| Compound Name | [4-(2-cyclohexylethoxy)-6-(ethylamino)-2,2-dimethyl-3,4-dihydrochromen-3-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 20803871 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | [4-(2-cyclohexylethoxy)-6-(ethylamino)-2,2-dimethyl-3,4-dihydrochromen-3-yl] furan-2-carboxylate |
| SMILES | CCNc1ccc2c(c1)C(OCCC1CCCCC1)C(OC(=O)c1ccco1)C(C)(C)O2 |
| InChI | InChI=1S/C26H35NO5/c1-4-27-19-12-13-21-20(17-19)23(30-16-14-18-9-6-5-7-10-18)24(26(2,3)32-21)31-25(28)22-11-8-15-29-22/h8,11-13,15,17-18,23-24,27H,4-7,9-10,14,16H2,1-3H3 |
| InChIKey | ZXVPCJUMEDQTLZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|