C27H35NO4 — CID 20804570
[6-(benzylamino)-4-ethoxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] cyclohexanecarboxylate (PubChem CID 20804570) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is [6-(benzylamino)-4-ethoxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] cyclohexanecarboxylate.
| Compound Name | [6-(benzylamino)-4-ethoxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 20804570 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | [6-(benzylamino)-4-ethoxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] cyclohexanecarboxylate |
| SMILES | CCOC1c2cc(NCc3ccccc3)ccc2OC(C)(C)C1OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C27H35NO4/c1-4-30-24-22-17-21(28-18-19-11-7-5-8-12-19)15-16-23(22)32-27(2,3)25(24)31-26(29)20-13-9-6-10-14-20/h5,7-8,11-12,15-17,20,24-25,28H,4,6,9-10,13-14,18H2,1-3H3 |
| InChIKey | PFSWYERVFQVYSR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|