C20H29NO4 — CID 20804444
[4-methoxy-2,2-dimethyl-6-(methylamino)-3,4-dihydrochromen-3-yl] cyclohexanecarboxylate (PubChem CID 20804444) has the molecular formula C20H29NO4 and a molecular weight of 347.45 g/mol. Its IUPAC name is [4-methoxy-2,2-dimethyl-6-(methylamino)-3,4-dihydrochromen-3-yl] cyclohexanecarboxylate.
| Compound Name | [4-methoxy-2,2-dimethyl-6-(methylamino)-3,4-dihydrochromen-3-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 20804444 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | [4-methoxy-2,2-dimethyl-6-(methylamino)-3,4-dihydrochromen-3-yl] cyclohexanecarboxylate |
| SMILES | CNc1ccc2c(c1)C(OC)C(OC(=O)C1CCCCC1)C(C)(C)O2 |
| InChI | InChI=1S/C20H29NO4/c1-20(2)18(24-19(22)13-8-6-5-7-9-13)17(23-4)15-12-14(21-3)10-11-16(15)25-20/h10-13,17-18,21H,5-9H2,1-4H3 |
| InChIKey | KYAUNJVKRFFPNK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|