C21H25NO5 — CID 20804440
[4-methoxy-2,2-dimethyl-6-(methylamino)-3,4-dihydrochromen-3-yl] 4-methoxybenzoate (PubChem CID 20804440) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is [4-methoxy-2,2-dimethyl-6-(methylamino)-3,4-dihydrochromen-3-yl] 4-methoxybenzoate.
| Compound Name | [4-methoxy-2,2-dimethyl-6-(methylamino)-3,4-dihydrochromen-3-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 20804440 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [4-methoxy-2,2-dimethyl-6-(methylamino)-3,4-dihydrochromen-3-yl] 4-methoxybenzoate |
| SMILES | CNc1ccc2c(c1)C(OC)C(OC(=O)c1ccc(OC)cc1)C(C)(C)O2 |
| InChI | InChI=1S/C21H25NO5/c1-21(2)19(26-20(23)13-6-9-15(24-4)10-7-13)18(25-5)16-12-14(22-3)8-11-17(16)27-21/h6-12,18-19,22H,1-5H3 |
| InChIKey | DOTCNBMGXYPQDH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|