C23H29NO5 — CID 20804299
[4-ethoxy-6-[(4-methoxyphenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate (PubChem CID 20804299) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is [4-ethoxy-6-[(4-methoxyphenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate.
| Compound Name | [4-ethoxy-6-[(4-methoxyphenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate |
|---|---|
| PubChem CID | 20804299 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | [4-ethoxy-6-[(4-methoxyphenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate |
| SMILES | CCOC1c2cc(NCc3ccc(OC)cc3)ccc2OC(C)(C)C1OC(C)=O |
| InChI | InChI=1S/C23H29NO5/c1-6-27-21-19-13-17(24-14-16-7-10-18(26-5)11-8-16)9-12-20(19)29-23(3,4)22(21)28-15(2)25/h7-13,21-22,24H,6,14H2,1-5H3 |
| InChIKey | HCFGCFXLWMDOJG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|