C32H43NO5 — CID 20803854
[4-(2-cyclohexylethoxy)-6-[(4-methoxyphenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] 3-methylbut-2-enoate (PubChem CID 20803854) has the molecular formula C32H43NO5 and a molecular weight of 521.70 g/mol. Its IUPAC name is [4-(2-cyclohexylethoxy)-6-[(4-methoxyphenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] 3-methylbut-2-enoate.
| Compound Name | [4-(2-cyclohexylethoxy)-6-[(4-methoxyphenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 20803854 |
| Molecular Formula | C32H43NO5 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | [4-(2-cyclohexylethoxy)-6-[(4-methoxyphenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] 3-methylbut-2-enoate |
| SMILES | COc1ccc(CNc2ccc3c(c2)C(OCCC2CCCCC2)C(OC(=O)C=C(C)C)C(C)(C)O3)cc1 |
| InChI | InChI=1S/C32H43NO5/c1-22(2)19-29(34)37-31-30(36-18-17-23-9-7-6-8-10-23)27-20-25(13-16-28(27)38-32(31,3)4)33-21-24-11-14-26(35-5)15-12-24/h11-16,19-20,23,30-31,33H,6-10,17-18,21H2,1-5H3 |
| InChIKey | AUBDIXGSSSUUEP-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|