C34H42ClNO4 — CID 20803476
3-[(3-chlorophenyl)methoxy]-4-(2-cyclohexylethoxy)-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine (PubChem CID 20803476) has the molecular formula C34H42ClNO4 and a molecular weight of 564.17 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methoxy]-4-(2-cyclohexylethoxy)-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine.
| Compound Name | 3-[(3-chlorophenyl)methoxy]-4-(2-cyclohexylethoxy)-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20803476 |
| Molecular Formula | C34H42ClNO4 |
| Molecular Weight | 564.17 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | 3-[(3-chlorophenyl)methoxy]-4-(2-cyclohexylethoxy)-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine |
| SMILES | COc1ccc(CNc2ccc3c(c2)C(OCCC2CCCCC2)C(OCc2cccc(Cl)c2)C(C)(C)O3)cc1 |
| InChI | InChI=1S/C34H42ClNO4/c1-34(2)33(39-23-26-10-7-11-27(35)20-26)32(38-19-18-24-8-5-4-6-9-24)30-21-28(14-17-31(30)40-34)36-22-25-12-15-29(37-3)16-13-25/h7,10-17,20-21,24,32-33,36H,4-6,8-9,18-19,22-23H2,1-3H3 |
| InChIKey | PPQXBLVIJZCQQD-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.17 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|