C27H38ClNO3 — CID 20804192
4-butoxy-N-[(3-chlorophenyl)methyl]-2,2-dimethyl-3-pentoxy-3,4-dihydrochromen-6-amine (PubChem CID 20804192) has the molecular formula C27H38ClNO3 and a molecular weight of 460.06 g/mol. Its IUPAC name is 4-butoxy-N-[(3-chlorophenyl)methyl]-2,2-dimethyl-3-pentoxy-3,4-dihydrochromen-6-amine.
| Compound Name | 4-butoxy-N-[(3-chlorophenyl)methyl]-2,2-dimethyl-3-pentoxy-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20804192 |
| Molecular Formula | C27H38ClNO3 |
| Molecular Weight | 460.06 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 4-butoxy-N-[(3-chlorophenyl)methyl]-2,2-dimethyl-3-pentoxy-3,4-dihydrochromen-6-amine |
| SMILES | CCCCCOC1C(OCCCC)c2cc(NCc3cccc(Cl)c3)ccc2OC1(C)C |
| InChI | InChI=1S/C27H38ClNO3/c1-5-7-9-16-31-26-25(30-15-8-6-2)23-18-22(13-14-24(23)32-27(26,3)4)29-19-20-11-10-12-21(28)17-20/h10-14,17-18,25-26,29H,5-9,15-16,19H2,1-4H3 |
| InChIKey | WHHSZOZUTVUWCZ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.06 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|