C25H32FNO3 — CID 20803637
4-butoxy-N-[(3-fluorophenyl)methyl]-2,2-dimethyl-3-prop-2-enoxy-3,4-dihydrochromen-6-amine (PubChem CID 20803637) has the molecular formula C25H32FNO3 and a molecular weight of 413.53 g/mol. Its IUPAC name is 4-butoxy-N-[(3-fluorophenyl)methyl]-2,2-dimethyl-3-prop-2-enoxy-3,4-dihydrochromen-6-amine.
| Compound Name | 4-butoxy-N-[(3-fluorophenyl)methyl]-2,2-dimethyl-3-prop-2-enoxy-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20803637 |
| Molecular Formula | C25H32FNO3 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 4-butoxy-N-[(3-fluorophenyl)methyl]-2,2-dimethyl-3-prop-2-enoxy-3,4-dihydrochromen-6-amine |
| SMILES | C=CCOC1C(OCCCC)c2cc(NCc3cccc(F)c3)ccc2OC1(C)C |
| InChI | InChI=1S/C25H32FNO3/c1-5-7-14-28-23-21-16-20(27-17-18-9-8-10-19(26)15-18)11-12-22(21)30-25(3,4)24(23)29-13-6-2/h6,8-12,15-16,23-24,27H,2,5,7,13-14,17H2,1,3-4H3 |
| InChIKey | NDIQRMMSIPQHIM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|