C26H34FNO3 — CID 20803748
3-[(E)-but-2-enoxy]-4-butoxy-N-[(4-fluorophenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine (PubChem CID 20803748) has the molecular formula C26H34FNO3 and a molecular weight of 427.56 g/mol. Its IUPAC name is 3-[(E)-but-2-enoxy]-4-butoxy-N-[(4-fluorophenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine.
| Compound Name | 3-[(E)-but-2-enoxy]-4-butoxy-N-[(4-fluorophenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20803748 |
| Molecular Formula | C26H34FNO3 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 3-[(E)-but-2-enoxy]-4-butoxy-N-[(4-fluorophenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine |
| SMILES | C/C=C/COC1C(OCCCC)c2cc(NCc3ccc(F)cc3)ccc2OC1(C)C |
| InChI | InChI=1S/C26H34FNO3/c1-5-7-15-29-24-22-17-21(28-18-19-9-11-20(27)12-10-19)13-14-23(22)31-26(3,4)25(24)30-16-8-6-2/h6,8-14,17,24-25,28H,5,7,15-16,18H2,1-4H3/b8-6+ |
| InChIKey | LIXFDPKSWJFDFI-SOFGYWHQSA-N |
| XLogP | 6.43 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|