C28H41NO4 — CID 20804215
4-butoxy-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3-pentoxy-3,4-dihydrochromen-6-amine (PubChem CID 20804215) has the molecular formula C28H41NO4 and a molecular weight of 455.64 g/mol. Its IUPAC name is 4-butoxy-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3-pentoxy-3,4-dihydrochromen-6-amine.
| Compound Name | 4-butoxy-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3-pentoxy-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20804215 |
| Molecular Formula | C28H41NO4 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | 4-butoxy-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3-pentoxy-3,4-dihydrochromen-6-amine |
| SMILES | CCCCCOC1C(OCCCC)c2cc(NCc3ccc(OC)cc3)ccc2OC1(C)C |
| InChI | InChI=1S/C28H41NO4/c1-6-8-10-18-32-27-26(31-17-9-7-2)24-19-22(13-16-25(24)33-28(27,3)4)29-20-21-11-14-23(30-5)15-12-21/h11-16,19,26-27,29H,6-10,17-18,20H2,1-5H3 |
| InChIKey | SAGHWWNSLQUOJR-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|