C22H29NO4 — CID 20804283
4-ethoxy-3-methoxy-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine (PubChem CID 20804283) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is 4-ethoxy-3-methoxy-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine.
| Compound Name | 4-ethoxy-3-methoxy-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20804283 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 4-ethoxy-3-methoxy-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine |
| SMILES | CCOC1c2cc(NCc3ccc(OC)cc3)ccc2OC(C)(C)C1OC |
| InChI | InChI=1S/C22H29NO4/c1-6-26-20-18-13-16(23-14-15-7-10-17(24-4)11-8-15)9-12-19(18)27-22(2,3)21(20)25-5/h7-13,20-21,23H,6,14H2,1-5H3 |
| InChIKey | NOEAMKJYXDJQCW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|