C27H37NO5 — CID 20804294
[4-ethoxy-6-[(4-methoxyphenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate (PubChem CID 20804294) has the molecular formula C27H37NO5 and a molecular weight of 455.60 g/mol. Its IUPAC name is [4-ethoxy-6-[(4-methoxyphenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate.
| Compound Name | [4-ethoxy-6-[(4-methoxyphenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 20804294 |
| Molecular Formula | C27H37NO5 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | [4-ethoxy-6-[(4-methoxyphenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate |
| SMILES | CCOC1c2cc(NCc3ccc(OC)cc3)ccc2OC(C)(C)C1OC(=O)CC(C)(C)C |
| InChI | InChI=1S/C27H37NO5/c1-8-31-24-21-15-19(28-17-18-9-12-20(30-7)13-10-18)11-14-22(21)33-27(5,6)25(24)32-23(29)16-26(2,3)4/h9-15,24-25,28H,8,16-17H2,1-7H3 |
| InChIKey | CILXKGYWETYVNY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|