C25H33NO4 — CID 20803921
[2,2-dimethyl-6-(methylamino)-4-phenylmethoxy-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate (PubChem CID 20803921) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is [2,2-dimethyl-6-(methylamino)-4-phenylmethoxy-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate.
| Compound Name | [2,2-dimethyl-6-(methylamino)-4-phenylmethoxy-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 20803921 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | [2,2-dimethyl-6-(methylamino)-4-phenylmethoxy-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate |
| SMILES | CNc1ccc2c(c1)C(OCc1ccccc1)C(OC(=O)CC(C)(C)C)C(C)(C)O2 |
| InChI | InChI=1S/C25H33NO4/c1-24(2,3)15-21(27)29-23-22(28-16-17-10-8-7-9-11-17)19-14-18(26-6)12-13-20(19)30-25(23,4)5/h7-14,22-23,26H,15-16H2,1-6H3 |
| InChIKey | UAECLHFOAFGNLC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|