C32H37NO4 — CID 20804550
[6-(benzylamino)-2,2-dimethyl-4-phenylmethoxy-3,4-dihydrochromen-3-yl] cyclohexanecarboxylate (PubChem CID 20804550) has the molecular formula C32H37NO4 and a molecular weight of 499.65 g/mol. Its IUPAC name is [6-(benzylamino)-2,2-dimethyl-4-phenylmethoxy-3,4-dihydrochromen-3-yl] cyclohexanecarboxylate.
| Compound Name | [6-(benzylamino)-2,2-dimethyl-4-phenylmethoxy-3,4-dihydrochromen-3-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 20804550 |
| Molecular Formula | C32H37NO4 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | [6-(benzylamino)-2,2-dimethyl-4-phenylmethoxy-3,4-dihydrochromen-3-yl] cyclohexanecarboxylate |
| SMILES | CC1(C)Oc2ccc(NCc3ccccc3)cc2C(OCc2ccccc2)C1OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C32H37NO4/c1-32(2)30(36-31(34)25-16-10-5-11-17-25)29(35-22-24-14-8-4-9-15-24)27-20-26(18-19-28(27)37-32)33-21-23-12-6-3-7-13-23/h3-4,6-9,12-15,18-20,25,29-30,33H,5,10-11,16-17,21-22H2,1-2H3 |
| InChIKey | QWECAKGLXKIOLH-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|