C27H37NO4 — CID 20804593
[6-(ethylamino)-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate (PubChem CID 20804593) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is [6-(ethylamino)-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate.
| Compound Name | [6-(ethylamino)-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 20804593 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | [6-(ethylamino)-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate |
| SMILES | CCNc1ccc2c(c1)C(OCCc1ccccc1)C(OC(=O)CC(C)(C)C)C(C)(C)O2 |
| InChI | InChI=1S/C27H37NO4/c1-7-28-20-13-14-22-21(17-20)24(30-16-15-19-11-9-8-10-12-19)25(27(5,6)32-22)31-23(29)18-26(2,3)4/h8-14,17,24-25,28H,7,15-16,18H2,1-6H3 |
| InChIKey | UYRHJPNPVXWHCK-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|