C31H37NO3 — CID 20803733
3-[(E)-but-2-enoxy]-2,2-dimethyl-N-[(2-methylphenyl)methyl]-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine (PubChem CID 20803733) has the molecular formula C31H37NO3 and a molecular weight of 471.64 g/mol. Its IUPAC name is 3-[(E)-but-2-enoxy]-2,2-dimethyl-N-[(2-methylphenyl)methyl]-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine.
| Compound Name | 3-[(E)-but-2-enoxy]-2,2-dimethyl-N-[(2-methylphenyl)methyl]-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20803733 |
| Molecular Formula | C31H37NO3 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | 3-[(E)-but-2-enoxy]-2,2-dimethyl-N-[(2-methylphenyl)methyl]-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine |
| SMILES | C/C=C/COC1C(OCCc2ccccc2)c2cc(NCc3ccccc3C)ccc2OC1(C)C |
| InChI | InChI=1S/C31H37NO3/c1-5-6-19-34-30-29(33-20-18-24-13-8-7-9-14-24)27-21-26(16-17-28(27)35-31(30,3)4)32-22-25-15-11-10-12-23(25)2/h5-17,21,29-30,32H,18-20,22H2,1-4H3/b6-5+ |
| InChIKey | ZRAZAWHPPDZWNC-AATRIKPKSA-N |
| XLogP | 7.04 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|