C24H29NO3 — CID 20804262
4-ethoxy-2,2-dimethyl-N-[(2-methylphenyl)methyl]-3-prop-2-ynoxy-3,4-dihydrochromen-6-amine (PubChem CID 20804262) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-ethoxy-2,2-dimethyl-N-[(2-methylphenyl)methyl]-3-prop-2-ynoxy-3,4-dihydrochromen-6-amine.
| Compound Name | 4-ethoxy-2,2-dimethyl-N-[(2-methylphenyl)methyl]-3-prop-2-ynoxy-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20804262 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 4-ethoxy-2,2-dimethyl-N-[(2-methylphenyl)methyl]-3-prop-2-ynoxy-3,4-dihydrochromen-6-amine |
| SMILES | C#CCOC1C(OCC)c2cc(NCc3ccccc3C)ccc2OC1(C)C |
| InChI | InChI=1S/C24H29NO3/c1-6-14-27-23-22(26-7-2)20-15-19(12-13-21(20)28-24(23,4)5)25-16-18-11-9-8-10-17(18)3/h1,8-13,15,22-23,25H,7,14,16H2,2-5H3 |
| InChIKey | HCNNJSSADSAUGW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|