C24H28FNO3 — CID 20804706
N-[(4-fluorophenyl)methyl]-2,2-dimethyl-4-propan-2-yloxy-3-prop-2-ynoxy-3,4-dihydrochromen-6-amine (PubChem CID 20804706) has the molecular formula C24H28FNO3 and a molecular weight of 397.49 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2,2-dimethyl-4-propan-2-yloxy-3-prop-2-ynoxy-3,4-dihydrochromen-6-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-2,2-dimethyl-4-propan-2-yloxy-3-prop-2-ynoxy-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20804706 |
| Molecular Formula | C24H28FNO3 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2,2-dimethyl-4-propan-2-yloxy-3-prop-2-ynoxy-3,4-dihydrochromen-6-amine |
| SMILES | C#CCOC1C(OC(C)C)c2cc(NCc3ccc(F)cc3)ccc2OC1(C)C |
| InChI | InChI=1S/C24H28FNO3/c1-6-13-27-23-22(28-16(2)3)20-14-19(11-12-21(20)29-24(23,4)5)26-15-17-7-9-18(25)10-8-17/h1,7-12,14,16,22-23,26H,13,15H2,2-5H3 |
| InChIKey | SENPFRZSSYPSDI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|