C21H26FNO3 — CID 102270302
(3S,4R)-6-[(4-fluorophenyl)methylamino]-2,2-dimethyl-4-propan-2-yloxy-3,4-dihydrochromen-3-ol (PubChem CID 102270302) has the molecular formula C21H26FNO3 and a molecular weight of 359.44 g/mol. Its IUPAC name is (3S,4R)-6-[(4-fluorophenyl)methylamino]-2,2-dimethyl-4-propan-2-yloxy-3,4-dihydrochromen-3-ol.
| Compound Name | (3S,4R)-6-[(4-fluorophenyl)methylamino]-2,2-dimethyl-4-propan-2-yloxy-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 102270302 |
| Molecular Formula | C21H26FNO3 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (3S,4R)-6-[(4-fluorophenyl)methylamino]-2,2-dimethyl-4-propan-2-yloxy-3,4-dihydrochromen-3-ol |
| SMILES | CC(C)O[C@@H]1c2cc(NCc3ccc(F)cc3)ccc2OC(C)(C)[C@H]1O |
| InChI | InChI=1S/C21H26FNO3/c1-13(2)25-19-17-11-16(23-12-14-5-7-15(22)8-6-14)9-10-18(17)26-21(3,4)20(19)24/h5-11,13,19-20,23-24H,12H2,1-4H3/t19-,20+/m1/s1 |
| InChIKey | NGDWTAIBZSLPQE-UXHICEINSA-N |
| XLogP | 4.44 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|