C22H26FNO4 — CID 20804375
[2,2-dimethyl-6-(methylamino)-4-propan-2-yloxy-3,4-dihydrochromen-3-yl] 4-fluorobenzoate (PubChem CID 20804375) has the molecular formula C22H26FNO4 and a molecular weight of 387.45 g/mol. Its IUPAC name is [2,2-dimethyl-6-(methylamino)-4-propan-2-yloxy-3,4-dihydrochromen-3-yl] 4-fluorobenzoate.
| Compound Name | [2,2-dimethyl-6-(methylamino)-4-propan-2-yloxy-3,4-dihydrochromen-3-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 20804375 |
| Molecular Formula | C22H26FNO4 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | [2,2-dimethyl-6-(methylamino)-4-propan-2-yloxy-3,4-dihydrochromen-3-yl] 4-fluorobenzoate |
| SMILES | CNc1ccc2c(c1)C(OC(C)C)C(OC(=O)c1ccc(F)cc1)C(C)(C)O2 |
| InChI | InChI=1S/C22H26FNO4/c1-13(2)26-19-17-12-16(24-5)10-11-18(17)28-22(3,4)20(19)27-21(25)14-6-8-15(23)9-7-14/h6-13,19-20,24H,1-5H3 |
| InChIKey | JJDQUSJWMLAVGA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|