C19H27NO4 — CID 20804242
[4-ethoxy-2,2-dimethyl-6-(methylamino)-3,4-dihydrochromen-3-yl] 3-methylbut-2-enoate (PubChem CID 20804242) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is [4-ethoxy-2,2-dimethyl-6-(methylamino)-3,4-dihydrochromen-3-yl] 3-methylbut-2-enoate.
| Compound Name | [4-ethoxy-2,2-dimethyl-6-(methylamino)-3,4-dihydrochromen-3-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 20804242 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | [4-ethoxy-2,2-dimethyl-6-(methylamino)-3,4-dihydrochromen-3-yl] 3-methylbut-2-enoate |
| SMILES | CCOC1c2cc(NC)ccc2OC(C)(C)C1OC(=O)C=C(C)C |
| InChI | InChI=1S/C19H27NO4/c1-7-22-17-14-11-13(20-6)8-9-15(14)24-19(4,5)18(17)23-16(21)10-12(2)3/h8-11,17-18,20H,7H2,1-6H3 |
| InChIKey | MIZGJBMJQMNYAS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|