C26H29NO4S — CID 20804259
[4-ethoxy-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] thiophene-2-carboxylate (PubChem CID 20804259) has the molecular formula C26H29NO4S and a molecular weight of 451.59 g/mol. Its IUPAC name is [4-ethoxy-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] thiophene-2-carboxylate.
| Compound Name | [4-ethoxy-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 20804259 |
| Molecular Formula | C26H29NO4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | [4-ethoxy-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] thiophene-2-carboxylate |
| SMILES | CCOC1c2cc(NCc3ccc(C)cc3)ccc2OC(C)(C)C1OC(=O)c1cccs1 |
| InChI | InChI=1S/C26H29NO4S/c1-5-29-23-20-15-19(27-16-18-10-8-17(2)9-11-18)12-13-21(20)31-26(3,4)24(23)30-25(28)22-7-6-14-32-22/h6-15,23-24,27H,5,16H2,1-4H3 |
| InChIKey | HBTMJINAMIPAIC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|