C28H31NO4 — CID 20804451
[4-methoxy-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] 4-methylbenzoate (PubChem CID 20804451) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is [4-methoxy-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] 4-methylbenzoate.
| Compound Name | [4-methoxy-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 20804451 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | [4-methoxy-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] 4-methylbenzoate |
| SMILES | COC1c2cc(NCc3ccc(C)cc3)ccc2OC(C)(C)C1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H31NO4/c1-18-6-10-20(11-7-18)17-29-22-14-15-24-23(16-22)25(31-5)26(28(3,4)33-24)32-27(30)21-12-8-19(2)9-13-21/h6-16,25-26,29H,17H2,1-5H3 |
| InChIKey | MZOOEOLMKSQUAL-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|