C35H43NO4 — CID 20803814
[4-(2-cyclohexylethoxy)-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] 4-methylbenzoate (PubChem CID 20803814) has the molecular formula C35H43NO4 and a molecular weight of 541.73 g/mol. Its IUPAC name is [4-(2-cyclohexylethoxy)-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] 4-methylbenzoate.
| Compound Name | [4-(2-cyclohexylethoxy)-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 20803814 |
| Molecular Formula | C35H43NO4 |
| Molecular Weight | 541.73 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | [4-(2-cyclohexylethoxy)-2,2-dimethyl-6-[(4-methylphenyl)methylamino]-3,4-dihydrochromen-3-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(CNc2ccc3c(c2)C(OCCC2CCCCC2)C(OC(=O)c2ccc(C)cc2)C(C)(C)O3)cc1 |
| InChI | InChI=1S/C35H43NO4/c1-24-10-14-27(15-11-24)23-36-29-18-19-31-30(22-29)32(38-21-20-26-8-6-5-7-9-26)33(35(3,4)40-31)39-34(37)28-16-12-25(2)13-17-28/h10-19,22,26,32-33,36H,5-9,20-21,23H2,1-4H3 |
| InChIKey | WFJUDTNGPMUOQB-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.73 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|