C30H41NO3 — CID 20804763
N-benzyl-3-[(E)-but-2-enoxy]-4-(2-cyclohexylethoxy)-2,2-dimethyl-3,4-dihydrochromen-6-amine (PubChem CID 20804763) has the molecular formula C30H41NO3 and a molecular weight of 463.66 g/mol. Its IUPAC name is N-benzyl-3-[(E)-but-2-enoxy]-4-(2-cyclohexylethoxy)-2,2-dimethyl-3,4-dihydrochromen-6-amine.
| Compound Name | N-benzyl-3-[(E)-but-2-enoxy]-4-(2-cyclohexylethoxy)-2,2-dimethyl-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20804763 |
| Molecular Formula | C30H41NO3 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | N-benzyl-3-[(E)-but-2-enoxy]-4-(2-cyclohexylethoxy)-2,2-dimethyl-3,4-dihydrochromen-6-amine |
| SMILES | C/C=C/COC1C(OCCC2CCCCC2)c2cc(NCc3ccccc3)ccc2OC1(C)C |
| InChI | InChI=1S/C30H41NO3/c1-4-5-19-33-29-28(32-20-18-23-12-8-6-9-13-23)26-21-25(16-17-27(26)34-30(29,2)3)31-22-24-14-10-7-11-15-24/h4-5,7,10-11,14-17,21,23,28-29,31H,6,8-9,12-13,18-20,22H2,1-3H3/b5-4+ |
| InChIKey | KQBGGMDHFQJKLP-SNAWJCMRSA-N |
| XLogP | 7.46 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|