C30H34FNO3 — CID 20803778
3-[(E)-but-2-enoxy]-N-[(4-fluorophenyl)methyl]-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine (PubChem CID 20803778) has the molecular formula C30H34FNO3 and a molecular weight of 475.60 g/mol. Its IUPAC name is 3-[(E)-but-2-enoxy]-N-[(4-fluorophenyl)methyl]-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine.
| Compound Name | 3-[(E)-but-2-enoxy]-N-[(4-fluorophenyl)methyl]-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20803778 |
| Molecular Formula | C30H34FNO3 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 3-[(E)-but-2-enoxy]-N-[(4-fluorophenyl)methyl]-2,2-dimethyl-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine |
| SMILES | C/C=C/COC1C(OCCc2ccccc2)c2cc(NCc3ccc(F)cc3)ccc2OC1(C)C |
| InChI | InChI=1S/C30H34FNO3/c1-4-5-18-34-29-28(33-19-17-22-9-7-6-8-10-22)26-20-25(15-16-27(26)35-30(29,2)3)32-21-23-11-13-24(31)14-12-23/h4-16,20,28-29,32H,17-19,21H2,1-3H3/b5-4+ |
| InChIKey | XMKBUEVAVWRTLA-SNAWJCMRSA-N |
| XLogP | 6.87 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|