C27H29F2NO3 — CID 20804270
4-ethoxy-3-[(3-fluorophenyl)methoxy]-N-[(4-fluorophenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine (PubChem CID 20804270) has the molecular formula C27H29F2NO3 and a molecular weight of 453.53 g/mol. Its IUPAC name is 4-ethoxy-3-[(3-fluorophenyl)methoxy]-N-[(4-fluorophenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine.
| Compound Name | 4-ethoxy-3-[(3-fluorophenyl)methoxy]-N-[(4-fluorophenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20804270 |
| Molecular Formula | C27H29F2NO3 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 4-ethoxy-3-[(3-fluorophenyl)methoxy]-N-[(4-fluorophenyl)methyl]-2,2-dimethyl-3,4-dihydrochromen-6-amine |
| SMILES | CCOC1c2cc(NCc3ccc(F)cc3)ccc2OC(C)(C)C1OCc1cccc(F)c1 |
| InChI | InChI=1S/C27H29F2NO3/c1-4-31-25-23-15-22(30-16-18-8-10-20(28)11-9-18)12-13-24(23)33-27(2,3)26(25)32-17-19-6-5-7-21(29)14-19/h5-15,25-26,30H,4,16-17H2,1-3H3 |
| InChIKey | WSDIYZXNSCAKPZ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|