C20H24FNO3 — CID 20804679
N-[(3-fluorophenyl)methyl]-3,4-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-6-amine (PubChem CID 20804679) has the molecular formula C20H24FNO3 and a molecular weight of 345.41 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-3,4-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-6-amine.
| Compound Name | N-[(3-fluorophenyl)methyl]-3,4-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20804679 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-3,4-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-6-amine |
| SMILES | COC1c2cc(NCc3cccc(F)c3)ccc2OC(C)(C)C1OC |
| InChI | InChI=1S/C20H24FNO3/c1-20(2)19(24-4)18(23-3)16-11-15(8-9-17(16)25-20)22-12-13-6-5-7-14(21)10-13/h5-11,18-19,22H,12H2,1-4H3 |
| InChIKey | RKZOTVXLFLLJPN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|