C33H42FNO3 — CID 20804145
4-butoxy-N-[(4-tert-butylphenyl)methyl]-3-[(4-fluorophenyl)methoxy]-2,2-dimethyl-3,4-dihydrochromen-6-amine (PubChem CID 20804145) has the molecular formula C33H42FNO3 and a molecular weight of 519.70 g/mol. Its IUPAC name is 4-butoxy-N-[(4-tert-butylphenyl)methyl]-3-[(4-fluorophenyl)methoxy]-2,2-dimethyl-3,4-dihydrochromen-6-amine.
| Compound Name | 4-butoxy-N-[(4-tert-butylphenyl)methyl]-3-[(4-fluorophenyl)methoxy]-2,2-dimethyl-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20804145 |
| Molecular Formula | C33H42FNO3 |
| Molecular Weight | 519.70 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | 4-butoxy-N-[(4-tert-butylphenyl)methyl]-3-[(4-fluorophenyl)methoxy]-2,2-dimethyl-3,4-dihydrochromen-6-amine |
| SMILES | CCCCOC1c2cc(NCc3ccc(C(C)(C)C)cc3)ccc2OC(C)(C)C1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C33H42FNO3/c1-7-8-19-36-30-28-20-27(35-21-23-9-13-25(14-10-23)32(2,3)4)17-18-29(28)38-33(5,6)31(30)37-22-24-11-15-26(34)16-12-24/h9-18,20,30-31,35H,7-8,19,21-22H2,1-6H3 |
| InChIKey | IEZABYBDOQQGNM-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.70 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|