C25H26FNO4S — CID 20804293
[4-ethoxy-6-[(4-fluorophenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] thiophene-2-carboxylate (PubChem CID 20804293) has the molecular formula C25H26FNO4S and a molecular weight of 455.55 g/mol. Its IUPAC name is [4-ethoxy-6-[(4-fluorophenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] thiophene-2-carboxylate.
| Compound Name | [4-ethoxy-6-[(4-fluorophenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 20804293 |
| Molecular Formula | C25H26FNO4S |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | [4-ethoxy-6-[(4-fluorophenyl)methylamino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] thiophene-2-carboxylate |
| SMILES | CCOC1c2cc(NCc3ccc(F)cc3)ccc2OC(C)(C)C1OC(=O)c1cccs1 |
| InChI | InChI=1S/C25H26FNO4S/c1-4-29-22-19-14-18(27-15-16-7-9-17(26)10-8-16)11-12-20(19)31-25(2,3)23(22)30-24(28)21-6-5-13-32-21/h5-14,22-23,27H,4,15H2,1-3H3 |
| InChIKey | JYKDBPAIJPMKBO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|