C21H33NO4 — CID 20804304
[4-ethoxy-6-(ethylamino)-2,2-dimethyl-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate (PubChem CID 20804304) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is [4-ethoxy-6-(ethylamino)-2,2-dimethyl-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate.
| Compound Name | [4-ethoxy-6-(ethylamino)-2,2-dimethyl-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 20804304 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | [4-ethoxy-6-(ethylamino)-2,2-dimethyl-3,4-dihydrochromen-3-yl] 3,3-dimethylbutanoate |
| SMILES | CCNc1ccc2c(c1)C(OCC)C(OC(=O)CC(C)(C)C)C(C)(C)O2 |
| InChI | InChI=1S/C21H33NO4/c1-8-22-14-10-11-16-15(12-14)18(24-9-2)19(21(6,7)26-16)25-17(23)13-20(3,4)5/h10-12,18-19,22H,8-9,13H2,1-7H3 |
| InChIKey | FSFHGZIMZAYHMY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|