C29H35NO3 — CID 20804827
N-ethyl-2,2-dimethyl-3-[(2-methylphenyl)methoxy]-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine (PubChem CID 20804827) has the molecular formula C29H35NO3 and a molecular weight of 445.60 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-3-[(2-methylphenyl)methoxy]-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine.
| Compound Name | N-ethyl-2,2-dimethyl-3-[(2-methylphenyl)methoxy]-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine |
|---|---|
| PubChem CID | 20804827 |
| Molecular Formula | C29H35NO3 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | N-ethyl-2,2-dimethyl-3-[(2-methylphenyl)methoxy]-4-(2-phenylethoxy)-3,4-dihydrochromen-6-amine |
| SMILES | CCNc1ccc2c(c1)C(OCCc1ccccc1)C(OCc1ccccc1C)C(C)(C)O2 |
| InChI | InChI=1S/C29H35NO3/c1-5-30-24-15-16-26-25(19-24)27(31-18-17-22-12-7-6-8-13-22)28(29(3,4)33-26)32-20-23-14-10-9-11-21(23)2/h6-16,19,27-28,30H,5,17-18,20H2,1-4H3 |
| InChIKey | RKLXALCCCGQAJU-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|